On Target TRPV1_RAT 0.65957445/CHEMBL342003
For the given ligand Acetaminophen, we have found in our database that, being scored 0.65957445, the most similar ligand is CHEMBL342003. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL342003 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Oc1ccc2cccc(NC(=O)Nc3ccccc3)c2c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00000006 00000008 20000000 00000a40 00000000 00000000 02000000 00002001 00000000 00000840 00280004 00008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40000100 08000408 20022000 00000000 00100000 00000000 00040000 00000080 00008000 00060001 00000000 00004000 |