On Target CASP1_HUMAN 0.2857143/CHEMBL1221595
For the given ligand Acetaminophen, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL1221595. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL1221595 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CC(C)[C@H](CC(=O)NCCNc1cccc(Cl)c1)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 0007c002 01003000 00100020 05000600 00000000 00000000 08000000 20000008 00200000 00000ac0 00200004 4003b800 0e008006 00002001 80000040 00080008 00040000 00000001 08c00010 00004201 40100000 38100f00 21000081 0210001a 00003001 00000000 00000000 10000080 08008002 00060001 20004000 00822200 |