On Target HPGDS_HUMAN 0.28688523/CHEMBL2035649
For the given ligand Acetaminophen, we have found in our database that, being scored 0.28688523, the most similar ligand is CHEMBL2035649. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL2035649 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | O=C(Nc1ccc(cc1)N2CCN(CC2)C(=O)N3CCOCC3)c4cnc(Oc5ccccc5)nc4 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 10004012 01007018 2000002a 84200e10 80001080 00004100 02004404 00407008 00000100 00020a50 40280004 40008000 0000a002 00102000 21001249 001c010c 30040010 02000000 08400040 40020000 c1120100 28050e00 32812060 0200000a 00040400 00000000 00800000 90002080 08008220 00460001 c0000000 84000280 |