On Target MDR1_HUMAN 0.37662336/CHEMBL311469
For the given ligand Acetaminophen, we have found in our database that, being scored 0.37662336, the most similar ligand is CHEMBL311469. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL311469 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CC(=O)Nc1ccc2c(Cc3ccccc23)c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 08006002 00000801 40000100 80010600 04000000 00000000 00000400 01000000 00400000 00080850 08280004 40008000 00008000 00308000 20000040 00000000 00060000 02000000 0c000000 00000000 44100000 08020600 30006010 00400010 00840000 a0000000 00000000 400000c0 0240c080 00060003 00000000 00000600 |