On Target PERM_HUMAN 0.27074236/CHEMBL3343353
For the given ligand 94, we have found in our database that, being scored 0.27074236, the most similar ligand is CHEMBL3343353. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3343353 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | C1Cn2nc3cc4OCOc4cc3c2S1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00000006 00904708 20020028 80100600 000c1000 00000000 060a0100 20000000 00200000 000048c0 4040100c 60018100 10005006 00c40000 01020201 002c800c 04000008 00000008 00680400 00260000 80040200 1d090018 21a00801 02200019 42104000 00000000 00800000 20003000 01001200 00060000 10000000 02434064 |