On Target ACES_HUMAN 0.37727273/CHEMBL432376
For the given ligand 94, we have found in our database that, being scored 0.37727273, the most similar ligand is CHEMBL432376. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL432376 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1cc2cc(C(=O)CCC3CC[N+](C)(Cc4ccccc4)CC3)n(C)c2cc1OC |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0001000a 01004808 2010110a 10010600 00041020 00000000 07080000 22001108 00000800 000808c0 08388004 50819000 0400c80e 00700000 01020441 0204800c 00000000 06000004 00202008 00060201 40100100 18068218 20802000 8050041c 00002040 c0000000 00000000 90000080 00000306 0086004b a0060200 20240600 |