On Target PAR1_HUMAN 0.31338027/CHEMBL3704471
For the given ligand 94, we have found in our database that, being scored 0.31338027, the most similar ligand is CHEMBL3704471. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3704471 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCN(CC)C1=NN2C(=N)N(CC(=O)c3cc(OCCCO)c(OC)c(c3)C(C)(C)C)N=C2C(=C1C)C |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0400500f 42801e09 68000199 10250610 00085085 8200c44c 46840000 00600200 01000300 11080ad0 0824400c 6800a000 0480d006 28200080 01024081 2a0ce00c 10048000 c2800008 09680000 40260604 c0100020 1c038260 23800843 83608014 20170c00 c0008000 60120018 009010c0 04000309 0806200a c0080384 00008760 |