On Target MK01_HUMAN 0.37254903/CHEMBL3968650
For the given ligand 94, we have found in our database that, being scored 0.37254903, the most similar ligand is CHEMBL3968650. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3968650 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1ccc(cc1F)[C@H](NC(=O)c2cc(F)c3cnc(Nc4ccnn4C)nc3c2)c5nccn5C |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000000f 01801808 20100d08 12050e00 000c1044 00184010 02842000 02003005 00000300 104838d1 0921800c 50008000 00009822 00401000 01020461 001c418c 00042808 12004003 00600000 30a20801 c0000001 3c038628 21802840 0260041c 01104000 c0000001 a0370040 900100c3 0100030c 00478803 c0048000 200006e0 |