On Target HYES_HUMAN 0.35470086/CHEMBL3677986
For the given ligand 94, we have found in our database that, being scored 0.35470086, the most similar ligand is CHEMBL3677986. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3677986 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | FC(F)(F)Oc1ccc(NC(=O)N[C@@H]2CC[C@H](CC2)Oc3ccnc(c3)C(=O)N4CCCC4)cc1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04000006 45001808 20104108 10010f00 001c1030 02100010 02000004 22003009 00000000 000008c0 00290004 40418000 00009822 00900080 11024441 220c210c 00840000 02400006 0a682000 00060201 40000100 18078610 21822008 0054801c 00110000 c0000000 00040240 d0000080 02008304 00060001 a00c0000 00244a00 |