On Target AMPN_HUMAN 0.324/CHEMBL1798008
For the given ligand 94, we have found in our database that, being scored 0.324, the most similar ligand is CHEMBL1798008. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1798008 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CC[C@H](C)[C@@H](CN1Cc2cc(OCC(=O)NO)ccc2C[C@H]1C(=O)Nc3ccc(OC)cc3)NC(=O)CC(C)(C)C |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0400c00a 45003218 60100128 14010602 20001020 00002000 03040000 22001008 00000880 00090ac0 083c0004 4001f000 068088a2 00302081 81021441 020c0018 10040200 820000a0 08080008 00120201 40120100 38248600 22006003 8354801a 00000800 c0000001 00164008 90000080 0c008300 0086000f 20044000 00002600 |