On Target ADRB2_HUMAN 0.50248754/CHEMBL1586182
For the given ligand 94, we have found in our database that, being scored 0.50248754, the most similar ligand is CHEMBL1586182. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1586182 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCn1c(SCC(=O)N2CCCC2)nnc1c3ccc(N)cc3 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000c006 00101908 e0100920 08118602 21010000 00000014 00800100 20082000 00060110 024248c0 0121010c 40008900 02008006 00040001 00020040 0008200c 04008000 02002000 80400000 02240241 40380000 1c040600 21300000 04484018 22000000 c0000000 10204000 10000060 00200004 00061001 80000a80 02210244 |