On Target PPARG_HUMAN 0.3735849/CHEMBL4069917
For the given ligand 94, we have found in our database that, being scored 0.3735849, the most similar ligand is CHEMBL4069917. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL4069917 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCCCNC(=O)NS(=O)(=O)c1ccc(NC(=O)CSC2=Nc3ccccc3C(=O)N2c4ccc(OC)cc4)cc1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00004012 00803208 211840a8 02b02e02 000d1050 00004020 0a008102 20003008 06160100 42006ce0 0138200c e0018400 00009806 007400c1 812400c1 000c000c 0e042008 00008200 08600020 00026011 c0102080 1a058638 21902841 89780018 22000000 90000000 a004c000 100404cc 2420c600 20460049 400c0000 032107e0 |