On Target CHLE_HUMAN 0.3604651/CHEMBL388615
For the given ligand 94, we have found in our database that, being scored 0.3604651, the most similar ligand is CHEMBL388615. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL388615 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | Clc1ccc2c(NCCCCCCCNC(=O)c3n[nH]c4ccccc34)c5CCCCc5nc2c1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0001c00a 01005808 60184102 10810e10 210c1120 00002042 0b00a000 22003409 10400800 001808d0 08318024 40918800 02008806 00600800 00020440 0204200e 00248200 0600000c 08602408 00220201 44100100 1c078718 20804800 8070001c 00146000 c0000001 08228040 90001080 00488106 00860003 a4068080 20424760 |