On Target PDE4B_HUMAN 0.3721973/CHEMBL286291
For the given ligand 94, we have found in our database that, being scored 0.3721973, the most similar ligand is CHEMBL286291. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL286291 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1ccc(cc1OC2CCCC2)C3CCN(C3)C(=O)c4cccn4C |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04000002 43009a08 20100108 10210f00 00081020 c2100010 02040000 22003005 00000880 000808c0 08390004 40018000 0080c802 20100080 11020401 020ca10c 00800000 02000006 00680000 00020201 00000101 18258600 21802000 8140001c 00100000 c0000000 00120000 90000000 04000304 0106004b a0000200 00004640 |