On Target TNFA_HUMAN 0.375969/CHEMBL142115
For the given ligand 94, we have found in our database that, being scored 0.375969, the most similar ligand is CHEMBL142115. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL142115 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | Cc1ccc(cc1)n2nc(cc2NC(=O)Nc3ccc(OCCN4CC[S+]([O-])CC4)c5ccccc35)C(C)(C)C |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04002007 40000a08 20000108 08558e42 05085080 00004002 02800000 00003209 00400104 520d48d0 09388004 40008050 80908a26 08340000 01011041 001c600c 14040000 0a800010 88400000 00220040 44000180 18058428 33826a40 87410030 00342000 c0000000 20174000 110008c1 0400831c 0046810b 40060000 820146e0 |