On Target ALDR_HUMAN 0.3229572/CHEMBL342974
For the given ligand 94, we have found in our database that, being scored 0.3229572, the most similar ligand is CHEMBL342974. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL342974 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | OC(=O)CC1=NN(CC(=O)Nc2cc(ccc2O)C(F)(F)F)C(=O)c3ccccc13 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00004006 01004408 60102120 40010702 050c00c0 80002022 02000400 00000200 06210001 c00c0ad0 082c800c 6001b004 01009002 01f00000 40040840 040d600c 08240000 c2020004 08a00000 00220250 60100000 3c050e18 21806881 02708012 0c140000 c0000101 30020448 90000080 09408104 00060053 00106800 00004600 |