On Target PGH1_SHEEP 0.3173913/CHEMBL1201124
For the given ligand 94, we have found in our database that, being scored 0.3173913, the most similar ligand is CHEMBL1201124. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1201124 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | NC(CO)(CO)CO.OC(=O)C1CCn2c1ccc2C(=O)c3ccccc3 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0002000a 00005a00 00101100 50010600 001000e0 00080000 00000000 21101100 00100900 100808c0 08188024 40819800 07008000 00100000 c00e0400 000c008c 18008000 06000085 09600008 00000001 00000100 18068a10 2b802000 0054041c 00000000 e0000080 08000010 50001000 00080084 0086004b a0007280 20000400 |