On Target NMDE2_HUMAN 0.41578948/CHEMBL146764
For the given ligand 94, we have found in our database that, being scored 0.41578948, the most similar ligand is CHEMBL146764. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL146764 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | Cc1n[nH]c(SCCN2CCC(Cc3ccccc3)CC2)n1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00000004 01100108 60100922 08118600 01000000 00000004 00800100 20002000 00120910 020a48c0 09300000 50018900 00000002 00240000 00020000 0008200c 04008000 02000000 80400000 00200241 00200100 18000000 20000000 04580010 00000000 80000000 00204000 10000000 00200004 00060002 80000080 02210644 |