On Target GRM5_HUMAN 0.34241244/CHEMBL3633976
For the given ligand 94, we have found in our database that, being scored 0.34241244, the most similar ligand is CHEMBL3633976. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3633976 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CC(=O)N1CCCn2nc(CN3CCOc4ccccc34)cc12 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 1400601f 00201409 60101108 00010e02 a5181080 08000002 02800000 00003400 00a00800 101009d0 083d002c 4011c000 00809422 00b40000 01231441 000c600c 10140000 0e800000 08400000 00220200 e1100080 180d8610 33c14801 02108018 00244000 40000001 2a370000 800000c1 0100830c 00060011 04088400 00008a68 |