On Target MDR1_HUMAN 0.36651585/CHEMBL259690
For the given ligand 94, we have found in our database that, being scored 0.36651585, the most similar ligand is CHEMBL259690. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL259690 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1cc2CCN(CCc3ccc(NC(=O)c4cc5ccccc5cn4)cc3)Cc2cc1OC |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000400a 46200808 20104108 50010e00 00061020 80100000 02040000 02001001 00000080 00080840 08290004 4000c000 0000c882 20708000 01020441 0204810c 00040200 02000020 08280000 00020200 40120000 18228608 20816000 81448014 00100000 c0000001 00324040 80000080 04008304 0006000b a0040000 00006600 |