On Target AGTR2_HUMAN 0.3245283/CHEMBL348126
For the given ligand 94, we have found in our database that, being scored 0.3245283, the most similar ligand is CHEMBL348126. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL348126 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCCCCN(C(=O)NC)c1ccc2nc(CCCC)n(Cc3ccc(NC(=O)c4c(Cl)ccc(Cl)c4C(=O)O)cc3)c2c1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000c00e 19801a00 00101500 90090e00 200c0060 0000e000 05008084 0a003101 90100100 100018c8 0128800c 4081c800 02009804 00708000 810300c0 020c000c 00040000 07000008 08780008 00010005 c0121900 18078fb0 21836045 8150043c 00112000 c0000600 20000080 90000080 04008104 00c60809 c80c0020 200246c0 |