On Target P2Y12_HUMAN 0.3127413/CHEMBL3326906
For the given ligand 94, we have found in our database that, being scored 0.3127413, the most similar ligand is CHEMBL3326906. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3326906 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCCC(=O)c1cnn(c1C)c2ccc(NC(=O)c3cn(CCC(=O)O)c4ccc(C)cc34)cc2 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 10004006 43801a08 20080182 40890610 010e1120 4010c002 00046000 02001004 00000900 008908c0 01280004 4001f000 8c009800 20700200 00000860 080c200c 00040008 82800004 08e80100 00220801 c0100000 18078e38 21816800 8350001c 00044000 c0000041 08020040 90000080 04408184 10460049 c00c8200 800006a0 |