On Target SCN9A_HUMAN 0.3830645/CHEMBL2296304
For the given ligand 94, we have found in our database that, being scored 0.3830645, the most similar ligand is CHEMBL2296304. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL2296304 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1ccc2c(OCC23C(=O)N(Cc4ccccn4)c5ccccc35)c1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04005003 00a00008 20104108 10010e00 20061060 02380040 42040000 0b003241 00000080 00080840 08290024 6001d080 11808802 00100000 41060561 020c211c 98248000 02000007 0ca00000 00020a01 c0100400 58218600 218120b0 83440019 00100001 e0000601 00120050 c0001080 04098384 00061003 22042000 20004640 |