On Target PGH2_HUMAN 0.35686275/CHEMBL317321
For the given ligand 94, we have found in our database that, being scored 0.35686275, the most similar ligand is CHEMBL317321. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL317321 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCn1nccc1NC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c4ccc(OC)cc24 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00008007 00000a09 20100188 51010718 200c5020 00000000 068c2000 00001000 80500010 100908c0 0838000c 4001b800 13009866 00f08000 c1220041 020c400c 00850200 83800004 01680400 00220200 40100080 18238718 21804801 93508015 00042000 c0000100 2a170000 100000c0 0500020c 0006004b 80042600 00020660 |