On Target ACE_HUMAN 0.35416666/CHEMBL301751
For the given ligand 94, we have found in our database that, being scored 0.35416666, the most similar ligand is CHEMBL301751. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL301751 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | OC(=O)CCN1C(=O)[C@H](COc2ccccc12)NC(=O)[C@@H](S)Cc3ccccc3 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04006002 00007208 20100128 04110602 a0001080 02200000 82000000 20000008 00030800 030d0ac0 083c0004 5001b000 1e808002 00142000 810a1041 000c6408 10240000 02000001 08800018 00020201 40140100 38140e00 334020a1 0640801a 00001801 80000000 20800040 100000c1 08008200 0006000b 20004c00 03012640 |