On Target 5HT1B_HUMAN 0.39013454/CHEMBL485427
For the given ligand 94, we have found in our database that, being scored 0.39013454, the most similar ligand is CHEMBL485427. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL485427 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | Cc1ccc2c(OC3CCN(CCc4ccc5OCC(=O)Nc5c4)CC3)cccc2n1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04006002 01000008 60105108 10010602 840410a0 02000000 06040000 20000008 00420080 000808d0 082c0004 5001c000 00808802 00501000 01021041 020c640c 00240000 82000004 08a00000 00060201 45100000 18248608 33802080 81508010 00040001 80000000 28120048 10000080 04408204 00060003 00040000 00242640 |