On Target TLR4_HUMAN 0.3320158/CHEMBL4068003
For the given ligand 94, we have found in our database that, being scored 0.3320158, the most similar ligand is CHEMBL4068003. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL4068003 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | Cn1c2C(=O)N(C(=Nc2c3cc(ccc13)c4ccccc4)SCC(=O)NC5CCCCC5)c6ccccc6 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000200a 01801200 201841a0 08112702 000d0040 0000c060 00008102 20001000 06560100 420248e0 0130000c 40018000 00009806 00e40080 100c00c0 000c0004 0c020008 02008204 06602020 00000213 c0000080 18048678 31900841 85780018 22000000 90000000 2000c048 10040040 24604000 00460049 400c0200 022107c0 |