On Target CNR2_HUMAN 0.5520362/CHEMBL496781
For the given ligand 94, we have found in our database that, being scored 0.5520362, the most similar ligand is CHEMBL496781. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL496781 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CCc1ccccc1NC(=O)CSc2nnc(c3ccccc3OC)n2c4ccccc4 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0001c006 0010010c e0084968 00118602 01011040 00000044 02800100 20083000 00060110 02084c41 8939012c 40008908 02008806 00140201 01060041 000c200c 0c048000 06002204 88400000 02260040 40380000 0a008600 a1b02000 0048c050 22000000 c0000040 30204010 000010e0 2028830c 00061043 80040a80 22210744 |