On Target NTRK1_HUMAN 0.37867647/CHEMBL1938736
For the given ligand 94, we have found in our database that, being scored 0.37867647, the most similar ligand is CHEMBL1938736. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1938736 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CC(C)c1nnc2ccc(Sc3ccccc3CNC(=O)Nc4cc(nn4c5ccccc5)C(C)(C)C)cn12 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000100f 00800208 600a4100 18118e00 050c4020 00204026 02800004 02207a01 00400304 512d08d0 09388005 63808810 10008a22 08b00000 00030040 021c600c 0424d000 0ac00004 80600000 00221841 c4000180 1c019420 21824802 83610039 00342400 d2000280 20170000 810109c0 0400031c 0046010b c00600c0 a00107e0 |