On Target MTOR_HUMAN 0.33118972/CHEMBL1091706
For the given ligand 94, we have found in our database that, being scored 0.33118972, the most similar ligand is CHEMBL1091706. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1091706 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CN(Cc1ccccn1)C(=O)C2CCN(CC2)c3ccnc4c3c(\C=C\5/Oc6ccc(NC(=O)Nc7cccnc7)cc6C5=O)cn4C |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 04025006 01800808 60104308 12090e72 240c1064 0a926000 82008281 22007649 01e60108 40b828d1 89ad800c 5003d000 84809822 08f00000 030604c3 124c215c 08040400 8290000a 8c238000 40020a07 c4100100 1a078638 2182a005 8058001d 01140002 c0000000 a844ac48 d0000088 2040c30c 20460003 e4040210 008066e0 |