On Target CAH2_HUMAN 0.41632652/CHEMBL3337996
For the given ligand 94, we have found in our database that, being scored 0.41632652, the most similar ligand is CHEMBL3337996. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL3337996 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1cccc2C(=S)N(Cc3ccccc3)C(=Nc12)SCC(=O)Nc4ccc(cc4)S(=O)(=O)N |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0006401a 00802208 61002528 00b12602 000d1010 00004004 07090100 20401008 00160100 02404cc0 0128208c 60058040 0000b807 08d40001 812000c5 000c000c 14040000 02000180 08600020 00022040 c0100000 1e008638 21902041 89480018 22002800 90000248 00004000 000000c8 04208200 20464349 400c0000 022102e8 |