On Target CDK5_HUMAN 0.36144578/CHEMBL2002613
For the given ligand 94, we have found in our database that, being scored 0.36144578, the most similar ligand is CHEMBL2002613. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL2002613 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | COc1cc(OC)cc(c1)C(=O)Nc2n[nH]c3ccc(cc23)c4cn(Cc5ccccc5)nn4 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00004003 54000a19 60000108 00010610 200c1040 00002008 46800000 02001000 00000100 100008c0 00390004 4000c800 000088a6 00508000 01074041 a00c600c 08060040 86000004 0c6c0000 00261a06 40120180 1c0a8608 21817800 8164c014 00320001 80200000 30040000 900020c0 0400c30c 00060009 90040200 1420c660 |