On Target IKKB_HUMAN 0.35211268/CHEMBL1807620
For the given ligand 94, we have found in our database that, being scored 0.35211268, the most similar ligand is CHEMBL1807620. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1807620 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CSCCNc1ccc2ncc(c3ccc(C(=O)NC[C@@H]4C[C@@H](F)CN4)c(F)c3)n2n1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 0000c083 01803809 e0101100 5e110610 01081060 0400009e 04c00000 22081a08 04000100 92016cc0 00208004 70018800 82018842 00543000 00070400 820c640c 0e268200 0280200c 0c200000 50660605 40100020 3e068620 21802803 6270c01c 00160401 c0080000 38106260 900008e1 0801410c 0446a441 e0040b00 12214600 |