On Target MK03_HUMAN 0.30131003/CHEMBL1336
For the given ligand 94, we have found in our database that, being scored 0.30131003, the most similar ligand is CHEMBL1336. Check out the elaboration below.
| 94 (Given Ligand) | CHEMBL1336 (Similar Ligand) |
|---|---|
| COc1ccccc1NC(=O)CSc3nnc(Cc2cccn2C)n3CCc4ccccc4 | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(c3)C(F)(F)F)cc2)ccn1 |
|
|
|
|
|
|
| 0000400e 00304308 70100928 10118e02 810b1020 00080004 06800100 2c003200 00060510 125c4cc0 0928810c 42818900 00008006 00140000 01020441 000c640c 04048000 02000007 88600000 00260a41 40300000 1e818600 21b02000 81488410 22000000 c0000201 20204040 d00100c0 04208204 0006004b a6000280 22210654 | 00008006 44000808 20104108 10010e40 04041020 00100000 02000400 02003009 00000000 00000850 00290004 40008804 02008826 09100000 01024041 2204010c 00040000 02000004 08282000 00060010 40402100 08028700 20822000 00448004 00142000 80000200 000c0040 90200080 00408384 00060001 80140400 02264200 |