On Target NMDZ1_HUMAN 0.16312057/CHEMBL164231
For the given ligand Hydralazine, we have found in our database that, being scored 0.16312057, the most similar ligand is CHEMBL164231. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL164231 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | C[C@@H](NCc1cc(cc2nc(O)c(O)nc12)C#N)P(=O)(O)O |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 10010012 02000e18 40000102 00010610 00040061 00c00004 1400c000 02601000 00000080 00800840 01200004 40008000 80000802 00420000 60840548 0004800c 08422028 0200004c 00a00000 00000000 40020020 0d308800 21800400 00400000 00044400 c4000004 08008440 80016004 01400100 20060400 00048000 84008223 |