On Target ACES_HUMAN 0.375/CHEMBL573102
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL573102. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL573102 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c2ccc(Cl)cc2 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00008010 01800200 01100000 01b00600 00080000 10000000 00000000 20000000 00000000 004008c0 00202000 70018800 02000006 00000001 80600000 00000000 00002000 00000000 00402000 00006601 80000000 18000110 00000000 18400018 02002000 00000004 10000000 1000000c 00000400 20060000 00020000 00030270 |