On Target ACES_HUMAN 0.35526314/CHEMBL374729
For the given ligand Omeprazole, we have found in our database that, being scored 0.35526314, the most similar ligand is CHEMBL374729. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL374729 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1ccc2[nH]c3c(C)[n+](C)ccc3c2c1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00000002 00000008 20004108 10010610 000c1060 00000000 06088000 00000000 00000000 000008c0 00000004 40018000 00000806 00c00000 01060041 0204000c 08000000 02000000 00600000 00020000 c0000000 18008018 21800000 80400000 00042000 c0000000 08008040 00000000 00000204 00060000 000c0200 00000400 |