On Target COMT_HUMAN 0.17763157/CHEMBL3798524
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.17763157, the most similar ligand is CHEMBL3798524. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL3798524 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | OC1=CN(C=CC1=O)c2cc(ccn2)c3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000a002 00000a08 60004100 00810600 400c100c 04004004 04000000 00201000 02108100 800008c0 00020004 60018800 82008804 00400000 80000000 000c000c 00020000 02004004 04200000 00262000 40000020 1c028110 30800800 81700008 06142400 80180000 08040280 00040040 04004008 00060008 40040000 01624020 |