On Target COMT_HUMAN 0.33695653/CHEMBL3797305
For the given ligand Hydralazine, we have found in our database that, being scored 0.33695653, the most similar ligand is CHEMBL3797305. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL3797305 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | OC1=CN(C=CC1=O)c2nccc3ccccc23 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00000002 00000208 60004000 00000600 400c0008 00004004 04000000 00201000 02108100 800008c0 00020004 00018000 00008804 00400000 00000040 000c000c 00000000 00004004 00200000 00260000 40000020 1c008018 20800800 81300000 06102400 00000000 00000080 00040000 04000008 00060008 40040000 00604000 |