On Target TRPV1_RAT 0.36936936/CHEMBL197770
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.36936936, the most similar ligand is CHEMBL197770. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL197770 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CC(C)(C)c1ccc(CNC(=O)NCc2ccc(NS(=O)(=O)C)c(Cl)c2)cc1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008002 08800800 00000102 80310e00 00000000 00000000 04000024 02003000 00000100 00080848 09202004 40008800 82108c04 00000001 80080040 00020040 00004000 02000000 00000040 00004000 c0000100 08018d00 20000000 00400018 00002080 80000400 00000000 8000000c 00000100 00060003 00040000 80030660 |