On Target FABP5_HUMAN 0.25306123/CHEMBL247920
For the given ligand Omeprazole, we have found in our database that, being scored 0.25306123, the most similar ligand is CHEMBL247920. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL247920 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | CCc1c(c2ccccc2)c(nn1c3ccccc3c4cccc(OCC(=O)O)c4)c5ccccc5 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 0400a006 40000209 a0000188 10010610 21081020 0010600a 02440000 00081200 00000104 100d88c0 01048084 6000c800 02808812 00300280 21220841 820c204c 00020240 82c03000 04480100 00621240 40020040 1841aa24 34806800 8b404518 00802001 c10800c0 14120008 00800861 04004384 1046040b 40861a00 800004a2 |