On Target FABP5_HUMAN 0.17880794/CHEMBL3941588
For the given ligand Hydralazine, we have found in our database that, being scored 0.17880794, the most similar ligand is CHEMBL3941588. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL3941588 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | OC(=O)c1c(nc2ccc(Cl)cc2c1c3ccccc3)N4CCCCC4 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 1801e002 01800801 40104100 00010610 20041004 0001e040 04000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 20020040 000c000e 00060000 02004004 0c200000 00a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |