On Target PAR1_HUMAN 0.25714287/CHEMBL313645
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.25714287, the most similar ligand is CHEMBL313645. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL313645 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CC(C)N(C[C@@H](O)c1ccc(Cl)c(Cl)c1)C(=O)Nc2ccc(CNC(=O)C(C)(C)C)cc2 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008016 14805800 00100100 80010e00 00000080 00004000 04000004 02003005 00000180 00080840 08280004 40009800 020098a6 00108000 80000440 00080008 30040008 02400000 08000000 00000200 c0000100 18218720 22022000 81480018 00112000 c0100000 00040000 80000080 04008100 00060003 60040000 00024600 |