On Target SC6A4_HUMAN 0.39285713/CHEMBL1172526
For the given ligand Hydralazine, we have found in our database that, being scored 0.39285713, the most similar ligand is CHEMBL1172526. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL1172526 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CC(C)CC1CNCCN1c2ccc3[nH]ncc3c2 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00004002 01000008 20100020 04000600 20040000 00002000 02000000 20000000 00000000 00000ac0 00200004 40018000 00000002 00402000 00020040 0004000c 00040000 00000008 08600000 00220605 40100000 3c000008 20800821 02300012 00100000 00000000 00000000 10000080 08008000 00060000 00000000 00004220 |