On Target MK01_HUMAN 0.2761194/CHEMBL1987756
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.2761194, the most similar ligand is CHEMBL1987756. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1987756 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | Brc1ccc(C=CCNCCNS(=O)(=O)c2cccc3cnccc23)cc1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00004092 00808000 01004100 01b10600 000c0000 00000000 80120080 00000400 00000000 00400840 00202004 60008000 00000812 00410001 80600042 00048004 20002400 02000100 00600000 00807801 c0000000 28008008 20800000 aa400028 02000000 80000104 005a2000 4001000c 08400400 20060000 0404000a 08010260 |