On Target HYES_HUMAN 0.32380953/CHEMBL550648
For the given ligand Omeprazole, we have found in our database that, being scored 0.32380953, the most similar ligand is CHEMBL550648. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL550648 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | CCCCn1c(nc2cc(ccc12)C(=O)NCc3cccc(OC)c3OC)c4cc(OC)c(OC)c(OC)c4 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00004003 44809808 20100108 10850600 200c1060 00006100 42040000 02081404 00000100 101018c0 0920800c 40018000 0000d822 00c08000 010206c1 020ca00c 00002088 02002004 00680000 00422a01 c0100000 38068630 a1800001 0054801c 00004000 c0000000 00020040 90000000 00400304 00460c49 c40c8800 000002a0 |