On Target TRPV3_HUMAN 0.26086956/CHEMBL3692265
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL3692265. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL3692265 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CCN(CC)S(=O)(=O)c1cccc(c1)c2ccc(F)c(CN[C@@H](CO)C(C)C)n2 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000209a 00800000 01104100 17b10e00 008c01a1 00190022 00400000 02083041 00000000 10020840 00212004 60008010 00000802 00001001 80220480 020c010d 12022200 02002022 04600000 00506201 c0000003 18018000 33800000 28400018 02100000 c0000004 00000c40 8000104d 00004504 20260402 21040800 20014260 |