On Target AMPN_HUMAN 0.28333333/CHEMBL2332518
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.28333333, the most similar ligand is CHEMBL2332518. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL2332518 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CC(C)C[C@H](NC(=O)NCc1ccccc1Cl)C(=O)NO |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00018000 01803010 40100100 00010e00 00000000 00000000 04000004 02003020 00000000 000208c0 01200000 4001b800 0600b804 00000000 00000000 00000010 00004000 02000010 00000040 000c0001 80000900 38058700 00000000 00400018 00412000 80000200 00000000 90000200 08000100 00060005 280c4000 80420200 |