On Target AMPN_HUMAN 0.21192053/CHEMBL328470
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.21192053, the most similar ligand is CHEMBL328470. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL328470 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CC(C)CN(CCCN1CCN(CCCNc2ccnc3cc(Cl)ccc23)CC1)C(=O)CC(=O)NO |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0001c002 00001410 40104000 04000600 200c0000 00000000 08008000 00000000 00000100 00000960 00200004 40009800 0a00880e 00402000 00020040 00040014 00040000 00000000 08200050 00040200 60100000 380c8708 20800021 82000018 00007000 00000000 00008000 00000080 08008000 00060015 00040000 00422240 |