On Target AOFA_HUMAN 0.38157895/CHEMBL1645554
For the given ligand Omeprazole, we have found in our database that, being scored 0.38157895, the most similar ligand is CHEMBL1645554. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL1645554 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | Cc1nccc2c3ccc(OCc4ccc5ccccc5c4)cc3[nH]c12 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 04000002 00000008 20004108 10010610 000c1060 00004000 06008000 00000008 00000100 00000840 00000004 40008000 00800802 00c10000 01060041 020c000c 08000000 02000004 00200000 00060000 40000000 08008028 21800000 80c01000 00040000 80002000 08008040 00000000 00000204 00060000 40040200 00200400 |